On Target DRD2_HUMAN 0.5081967/CHEMBL127114
For the given ligand Lisinopril, we have found in our database that, being scored 0.5081967, the most similar ligand is CHEMBL127114. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL127114 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | COc1ccccc1N2CCN(CCCCNC(=O)C3CC3c4ccccc4)CC2.OC(=O)C(=O)O |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00014002 01001208 2010012a 04010600 80001000 00000000 02000000 20000000 04300800 00080ac0 08300004 4003d000 04008002 01202000 01000041 000c4008 00040000 02000000 08000008 00020201 40100100 38040e00 24000021 0250801a 00000800 80000000 20000000 10000080 08008200 0006000b 00000800 00402600 |