On Target NEP_HUMAN 0.40229884/CHEMBL148840
For the given ligand Fosinopril, we have found in our database that, being scored 0.40229884, the most similar ligand is CHEMBL148840. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL148840 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | OC(=O)[C@@H]1CCCCCc2cccc(C[C@@H](CS)C(=O)N1)c2 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00010000 01005200 00100102 00110600 00080081 00000000 00000000 20000000 00000800 000808c0 08300000 4001b000 0600800a 00a40000 80080000 000c0008 10000000 02000000 00402008 00400201 60000100 18040e10 03000300 00500018 00000800 80000000 00000000 10800000 00000002 0006003b 20024000 01012600 |