On Target NEP_HUMAN 0.607362/CHEMBL51576
For the given ligand Moexipril, we have found in our database that, being scored 0.607362, the most similar ligand is CHEMBL51576. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL51576 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | OC(=O)CN1Cc2ccccc2C[C@H](NC(=O)[C@@H](S)Cc3ccccc3)C1=O |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00008008 00807200 00100100 14110600 000000a0 00000000 81000000 2200100c 00000880 030f08c0 08300000 4000b000 06008882 00242001 80180480 020c0008 10000200 02000000 00000008 00000201 80020100 38208e00 02004001 87400018 00000880 c0000001 00004000 90000040 0c000100 0186000b 20044000 03012600 |