On Target HPGDS_HUMAN 0.24186046/CHEMBL3650224
For the given ligand Fosinopril, we have found in our database that, being scored 0.24186046, the most similar ligand is CHEMBL3650224. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL3650224 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | O=C(Nc1ccc(cc1)N2CCC(CC2)C(=O)N3CCOCC3)N4CCN(CC4)C(=O)c5ccccc5 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00024006 01007800 00100100 84010e00 20000080 00002000 00000004 22003009 00200000 000308c0 00280004 50039000 0400a802 00102000 000a1448 00080108 10040010 02400000 08000000 00000201 40100100 38078600 32022020 0250001c 00100400 c0000000 00800000 90000081 08008300 00060001 80040000 00804200 |