On Target HPGDS_HUMAN 0.3873874/CHEMBL3903606
For the given ligand Moexipril, we have found in our database that, being scored 0.3873874, the most similar ligand is CHEMBL3903606. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL3903606 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | CC(NC(=O)C(Cc1ccccc1)NC(=O)c2ccc(nc2)c3cccs3)C(=O)N |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 1001a002 0080ba00 00104100 54010610 00041020 00000000 000c4080 3a18100c 00800b80 100908d1 09300204 4000b280 86008812 00002001 80022480 020c0004 00028000 0200200c 04210008 30400201 c1000100 79248e80 30800003 8340011c 02040800 c4000000 08000040 90000244 0c50411c 0006040b a0004800 80c10600 |