On Target HPGDS_HUMAN 0.34246576/CHEMBL3650224
For the given ligand Lisinopril, we have found in our database that, being scored 0.34246576, the most similar ligand is CHEMBL3650224. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL3650224 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | O=C(Nc1ccc(cc1)N2CCC(CC2)C(=O)N3CCOCC3)N4CCN(CC4)C(=O)c5ccccc5 |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00024006 01007800 00100100 84010e00 20000080 00002000 00000004 22003009 00200000 000308c0 00280004 50039000 0400a802 00102000 000a1448 00080108 10040010 02400000 08000000 00000201 40100100 38078600 32022020 0250001c 00100400 c0000000 00800000 90000081 08008300 00060001 80040000 00804200 |