On Target NOS1_HUMAN 0.2755102/CHEMBL1270460
For the given ligand Fosinopril, we have found in our database that, being scored 0.2755102, the most similar ligand is CHEMBL1270460. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL1270460 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | Fc1cccc(CCNCCO[C@H]2CNC[C@H]2CC3CCCC(=N)N3)c1 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00000000 01000000 00100100 82010f00 00180080 00000010 00000000 20002000 00200280 000828c3 08210000 50038000 00000002 00881000 00081008 00181008 10a00000 02000000 00c02000 00000201 00000020 18230030 13000080 81500010 30000400 80000000 c0000200 10000001 04200210 00068002 80020000 00002e00 |