On Target NK1R_HUMAN 0.37696335/CHEMBL3085126
For the given ligand Fosinopril, we have found in our database that, being scored 0.37696335, the most similar ligand is CHEMBL3085126. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL3085126 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | CC(C(=O)NC1(CCC(CC1)N2CCC(CC2)C3CCC(=O)O3)c4ccccc4)c5cc(cc(c5)C(F)(F)F)C(F)(F)F |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00050040 01891000 00100102 00010700 00181001 00000000 00000400 22001000 00300880 000808d0 08300000 50039002 0500880a 01a00000 40080400 00081008 00020000 02000000 02402000 00000201 80000120 18248e10 01000000 81500018 00000400 c0000000 00000200 90004000 04000302 00060003 20162000 00002e00 |