On Target NK1R_HUMAN 0.4563107/CHEMBL156933
For the given ligand Captopril, we have found in our database that, being scored 0.4563107, the most similar ligand is CHEMBL156933. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL156933 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CCCCCN(CCCCC)C(=O)[C@H]1CCN([C@@H](C1)C(=O)O)C(=O)N(c2ccccc2)c3ccccc3 |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00030016 01005000 00100000 00000e00 00080080 00000000 00000014 20002001 00202000 000208c0 00280004 5003b000 0600903a 01900000 80080040 00080008 30040000 00400000 08402002 00000201 40000100 18050e10 23022000 00100018 00110000 00000000 02000000 10000080 00008000 00060001 20084000 00806200 |