On Target OPRK_HUMAN 0.7106918/CHEMBL76089
For the given ligand Moexipril, we have found in our database that, being scored 0.7106918, the most similar ligand is CHEMBL76089. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL76089 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | Cc1cc(O)cc(C)c1C[C@H](N)C(=O)N2Cc3ccccc3C[C@H]2COCc4ccccc4 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00000008 40805208 20100100 90010700 000000b1 00004000 03001000 22001004 00000980 000908c0 08301000 4000b000 04008882 00210000 00181488 020c1008 10000200 02000020 00400008 00020201 80020120 38208620 13004041 83400018 00000c00 c0002001 009a4000 90000001 0c000300 0086000b 60040000 02002600 |