On Target ALDR_HUMAN 0.43523315/CHEMBL10350
For the given ligand Moexipril, we have found in our database that, being scored 0.43523315, the most similar ligand is CHEMBL10350. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL10350 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | OC(=O)CC1C(=O)N(Cc2ccc(Br)cc2F)C(=O)c3ccc(F)cc13 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00064088 00809800 00900100 12010600 00100020 00008010 01001000 22001006 00000880 000828c0 08300004 50009000 05008892 00201000 40200480 00080008 02002210 02000920 00400008 00100201 80c20100 18268e40 01004040 a140001c 00000804 c0000101 80124000 90000001 04300102 01868003 a0042008 08800e00 |