On Target ALDR_HUMAN 0.33783785/CHEMBL71562
For the given ligand Ramipril, we have found in our database that, being scored 0.33783785, the most similar ligand is CHEMBL71562. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL71562 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | CCC[C@@H]1C[C@@](O)(CC(=O)O)c2cc(F)ccc2O1 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 04010000 01000018 2010010a 02010300 00081000 82004010 06000000 00000a00 00000900 01082840 08100000 50009040 1680802a 02a01000 11000001 00082008 00800000 22008000 01402008 00420001 00000100 08000a20 01001040 02400410 00000800 c0000002 80000000 00000001 00100302 0003c002 40024000 00000600 |