On Target AA1R_HUMAN 0.31724137/CHEMBL3350613
For the given ligand Captopril, we have found in our database that, being scored 0.31724137, the most similar ligand is CHEMBL3350613. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL3350613 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CC(C)(C)OC(=O)C1CCCN1C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(=O)N)NC(=O)OCc3ccccc3 |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 01030000 01407400 00100102 84010700 00080080 0001c010 00000000 2000000c 00b00b80 000809e0 08300000 4003b000 0e008012 01212002 80381008 021a1008 10820000 02080401 00400890 00000201 00000120 38280eb0 13000041 83500018 00004400 80002002 00000000 10200021 0c000202 00060013 e0004000 00802600 |