On Target PGH1_SHEEP 0.3/CHEMBL3809863
For the given ligand Fosinopril, we have found in our database that, being scored 0.3, the most similar ligand is CHEMBL3809863. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL3809863 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | CC(C)C[C@H](NC(=O)CNC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C)C(=O)N[C@@H](C)C(=O)O |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 01010000 01407000 00100100 04010600 00000080 0001c000 00000000 20000008 00800300 000008c0 00200000 4001b000 0e008002 00012001 80180000 021a0008 10020000 02080400 00000890 00000201 00000000 38040e30 03000003 02500018 00000000 80002002 00000000 10200020 08000200 00060001 e0004000 00000200 |