On Target PGH1_SHEEP 0.3904762/CHEMBL3809863
For the given ligand Captopril, we have found in our database that, being scored 0.3904762, the most similar ligand is CHEMBL3809863. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL3809863 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CC(C)C[C@H](NC(=O)CNC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C)C(=O)N[C@@H](C)C(=O)O |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 01010000 01407000 00100100 04010600 00000080 0001c000 00000000 20000008 00800300 000008c0 00200000 4001b000 0e008002 00012001 80180000 021a0008 10020000 02080400 00000890 00000201 00000000 38040e30 03000003 02500018 00000000 80002002 00000000 10200020 08000200 00060001 e0004000 00000200 |