On Target PGH1_SHEEP 0.42028984/CHEMBL24798
For the given ligand Moexipril, we have found in our database that, being scored 0.42028984, the most similar ligand is CHEMBL24798. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL24798 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | CCC(C)[C@@H](CO)NC(=O)Cc1c(C)n(C(=O)c2ccc(Cl)cc2)c3ccc(OC)cc13 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00008002 01005a08 20100188 51010718 000c50a0 00000000 060c2000 20001000 80500080 000908c0 08200004 4001b800 13008866 00608000 c10a0041 020c000c 10810200 83800004 01680400 00020201 40000000 18268718 23804001 9150001c 00042000 c0000100 08160000 10000000 04000204 0006004b 80042200 00022620 |