On Target PGH1_SHEEP 0.496063/CHEMBL3809863
For the given ligand Ramipril, we have found in our database that, being scored 0.496063, the most similar ligand is CHEMBL3809863. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL3809863 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | CC(C)C[C@H](NC(=O)CNC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C)C(=O)N[C@@H](C)C(=O)O |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 01010000 01407000 00100100 04010600 00000080 0001c000 00000000 20000008 00800300 000008c0 00200000 4001b000 0e008002 00012001 80180000 021a0008 10020000 02080400 00000890 00000201 00000000 38040e30 03000003 02500018 00000000 80002002 00000000 10200020 08000200 00060001 e0004000 00000200 |