On Target CNR1_HUMAN 0.5185185/CHEMBL175247
For the given ligand Ramipril, we have found in our database that, being scored 0.5185185, the most similar ligand is CHEMBL175247. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL175247 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | CCCCCCCCCCC[C@@H](C[C@@H]1OC(=O)[C@H]1CCCCCC)OC(=O)[C@H](CC(C)C)NC=O |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00010040 01005000 00100100 80010700 000800c0 00000000 00000000 00000000 00000000 01000080 00200000 4000b000 14008028 02800000 00001008 00081008 10820000 00000000 01402000 00000001 00000020 10040e00 13000000 00000018 10000400 00000000 00800000 10000000 00000200 0004000b 20024000 00000200 |