On Target NMDE2_HUMAN 0.26589596/CHEMBL305187
For the given ligand Fosinopril, we have found in our database that, being scored 0.26589596, the most similar ligand is CHEMBL305187. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL305187 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | CC(C(O)c1ccc(O)cc1)N2CCC(Cc3ccccc3)CC2 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00000000 01000008 20100102 00010600 00000080 00004000 02000000 20000000 00100980 000808c0 08300000 50018000 00000002 00200000 00080000 00080008 10000000 02000000 00000000 00020201 00000100 18200020 03000000 81500010 00000000 80000000 00520000 10000000 04000000 00060002 40000000 00002600 |