On Target NMDE2_HUMAN 0.2815534/CHEMBL217955
For the given ligand Captopril, we have found in our database that, being scored 0.2815534, the most similar ligand is CHEMBL217955. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL217955 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | O=C(CCc1ccccc1)N2CCC(CNc3ncccn3)CC2 |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00000002 01001200 00100100 00010600 00000000 00004000 00002000 20100000 00200900 200808c0 08300004 50039000 04008002 00000000 00000000 000c0004 00000000 02004000 00400008 00a00201 00000100 1c040600 20800840 00500018 00000800 80000000 00000000 10000000 00000008 0046080b 40001000 00002680 |