On Target NMDE2_HUMAN 0.40366971/CHEMBL3357791
For the given ligand Ramipril, we have found in our database that, being scored 0.40366971, the most similar ligand is CHEMBL3357791. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL3357791 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | C1C[C@@H](CC[C@@H]1NC2CCc3ccccc3CC2)c4ccccc4 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00000000 01000200 00100102 00010600 00000000 00000002 00000000 20000001 00100800 000808c0 08300000 40018000 00000002 00200000 00000020 02040000 01000000 02000000 02002000 00000201 00000100 18000010 00004000 00500010 00000000 80000001 00000000 10000000 00000002 0006000a 00020000 00002600 |