On Target GRM5_HUMAN 0.41322315/CHEMBL92162
For the given ligand Lisinopril, we have found in our database that, being scored 0.41322315, the most similar ligand is CHEMBL92162. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL92162 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | N[C@@](CC1c2ccccc2Sc3ccccc13)([C@@H]4C[C@@H](C4)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00010000 01800200 00020102 00110600 000e0000 00100020 00000000 01004002 00000800 000808c0 08100400 6001b000 0c008018 01a00010 00000000 00080008 04001000 02000004 00602010 00000001 80000100 18000a00 03800000 00400019 00003000 a0000000 00000000 40001000 00000282 0007000a 00020100 00410420 |