On Target P2RX3_HUMAN 0.54347825/CHEMBL395723
For the given ligand Lisinopril, we have found in our database that, being scored 0.54347825, the most similar ligand is CHEMBL395723. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL395723 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | CC(C)C[C@H](N)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N2CCC[C@H]2C(=O)N[C@@H](Cc3c[nH]c4ccccc34)C(=O)N[C@@H]([C@@H](C)O)C(=O)O |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00010002 01007a08 20100100 45810610 00041280 00000010 02002000 2000000c 00400880 000908c0 08300004 4001b000 1e008812 00402801 80180040 000c000c 10000000 02000000 01600408 00020201 40000100 38248e28 23800003 93500018 00043800 80000000 08120000 10000000 0c000000 0006000b 20044200 00002620 |