On Target DRD3_HUMAN 0.5421687/CHEMBL3780140
For the given ligand Moexipril, we have found in our database that, being scored 0.5421687, the most similar ligand is CHEMBL3780140. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL3780140 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | CCCCCOc1ccc2CC3N(CCc4cc(OC)c(O)cc34)Cc2c1OC |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 04000008 47000008 20100108 10210700 00081020 c2000102 02040000 02001401 00000880 00180840 08300000 40808000 00804882 20200080 11000401 0208a008 00802200 02000020 00480000 00020201 00020100 18308000 01404000 81448010 00000000 c0000001 00324000 80000000 04000300 0086000a 24040000 00002740 |