On Target DRD3_HUMAN 0.55172414/CHEMBL1221512
For the given ligand Ramipril, we have found in our database that, being scored 0.55172414, the most similar ligand is CHEMBL1221512. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL1221512 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | CC[C@H](C)[C@@H](CO[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCS(=O)(=O)C)C(=O)OC(C)C)NC[C@@H](N)CS |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00000040 05005200 00300100 80110740 000800c0 02002200 00000000 20000040 84000800 000848c0 08302000 4008f000 06018002 04040002 803c1008 180c1008 1c821000 82000000 04400008 00000201 40010120 38000e03 13000301 0244001c 38000c00 80000000 00800000 10000001 08000200 0006002b 20004000 03012620 |