On Target MDR1_HUMAN 0.3783784/CHEMBL350775
For the given ligand Fosinopril, we have found in our database that, being scored 0.3783784, the most similar ligand is CHEMBL350775. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL350775 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | COc1cc(cc(OC)c1OC)C(=O)C(=O)N2CCCC[C@H]2C(=O)OC(CCCc3cccnc3)CCCc4cccnc4 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00010043 43005808 2010410b 80810710 000c1180 80000000 42042000 20000000 04400880 000808c0 08302004 5001b000 0700c80a 20a00802 c1085009 200c900c 10820000 02000004 00682400 00020a01 40000120 18268e10 33800000 8150001c 10040400 80000000 08920000 10010001 04400202 0006000b a0026000 00002600 |