On Target MDR1_HUMAN 0.7107438/CHEMBL1790684
For the given ligand Ramipril, we have found in our database that, being scored 0.7107438, the most similar ligand is CHEMBL1790684. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL1790684 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | CC[C@H](C)[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@H](Cc3ccccc3)N(C)C(=O)[C@H](Cc4ccccc4)NC(=O)[C@H](C(C)C)N(C)C(=O)[C@H](OC(=O)CN(C)C(=O)[C@H](CC(C)C)NC(=O)[C@H](C(C)C)N(C)C1=O)[C@@H](C)CC |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00010000 01007200 00100300 84010700 00000080 00000010 00000000 2000000c 00000880 000808c0 08300000 4001f000 06008012 00002003 80181008 100c1008 10060000 82000000 00400008 00000201 00000120 38240e20 13000003 8350001c 30000c00 80000000 00800000 10000001 0c000200 0006000b 20004000 02002600 |