On Target AGTR2_HUMAN 0.69491524/CHEMBL423236
For the given ligand Moexipril, we have found in our database that, being scored 0.69491524, the most similar ligand is CHEMBL423236. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL423236 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | CCOC(=O)C1Cc2c(CN1C(=O)C(c3ccccc3)c4ccccc4)ccc(OC)c2OCc5ccccc5 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 04008008 46805008 20100108 90210700 000010a0 c0004000 07041000 03001204 00000980 00080840 08300000 4000b0c0 0780c882 20210080 c1081489 0208b008 90020200 02008020 00480008 00020201 80020120 18208e20 13004040 81c49418 00004c00 e0002001 00a24000 c0000001 04000380 0087000b 60046000 00002600 |