On Target OPRM_MOUSE 0.6219512/CHEMBL330991
For the given ligand Moexipril, we have found in our database that, being scored 0.6219512, the most similar ligand is CHEMBL330991. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL330991 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | CC(C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H]1Cc2ccccc2CN1C(=O)[C@@H](C)NC(=O)[C@@H](N)Cc3ccc(O)cc3)C(C)C)C(=O)NCC(=O)N |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00068008 00803208 20100100 14010600 00100020 00000000 03000000 2200100c 00000880 000908c0 08300000 4000b000 0e008882 00202001 80000480 020c0008 00000200 02000021 00c00018 00020201 80020100 38308e00 01004083 83400018 00001801 c0000001 00124000 90000000 0c000102 0086000b 20044000 00802e00 |