On Target P2Y12_HUMAN 0.32592592/CHEMBL88108
For the given ligand Captopril, we have found in our database that, being scored 0.32592592, the most similar ligand is CHEMBL88108. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL88108 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | OC(=O)CN(C1CCCCC1)C(=O)CCCOc2ccc3[nH]c4nc(O)nc4cc3c2 |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 04044002 03005818 20184008 00010700 001c10c0 0200c000 06088000 20000000 00400100 000008c0 00208004 4001b000 06808806 00c00000 f10c0141 000c200c 18000000 00000100 02602000 00020201 40020000 18048e38 23800000 8010001c 00002000 00000000 00028200 10000000 00000200 00460001 e0044000 0c002e80 |