On Target P2Y12_HUMAN 0.4178082/CHEMBL599606
For the given ligand Ramipril, we have found in our database that, being scored 0.4178082, the most similar ligand is CHEMBL599606. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL599606 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | CCOC(=O)N1CCN(CC1)C(=O)[C@H](CCC(=O)O)NC(=O)c2cc(cc(c2)c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 0003a000 01403800 00100100 04010600 00180001 04010000 10000000 22001008 00800200 000308c0 00200000 4001b000 06808832 01002000 00000400 081a0008 00020000 02001000 04400800 00000201 00000000 38068e10 11000023 0250001c 00000000 c0000002 08000000 90200061 18004300 00060001 a0044000 00800a00 |