On Target NOS2_HUMAN 0.2651515/CHEMBL1911987
For the given ligand Fosinopril, we have found in our database that, being scored 0.2651515, the most similar ligand is CHEMBL1911987. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL1911987 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | Cc1cc(nc(n1)n2ccnc2)C3CCCN3CC(=O)NCc4ccc5OCOc5c4 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00018002 45800808 2010110a 44050e00 450010c4 00104012 13042000 2a003101 00300900 000d08c0 4033800c 4001a800 0a00d803 20302000 81020401 002c800c 00208008 06800002 80480008 00220241 80240620 3c038600 258008c1 0254811c 40106400 c1000600 08220000 b0000080 0900030c 00460003 6004c000 200142a0 |