On Target NOS2_HUMAN 0.42543858/CHEMBL222364
For the given ligand Moexipril, we have found in our database that, being scored 0.42543858, the most similar ligand is CHEMBL222364. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL222364 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | CCOC(=O)CN1CCN(C(CC(=O)NCc2ccc3OCOc3c2)C1)c4ccnc(n4)n5ccnc5 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00030002 44800409 20101128 8c090600 620010c8 00004000 0284a000 22101a00 00200100 00000be0 4022800c 7003b000 0e00d803 20002101 815a1409 003c800c 10068000 02804000 00480010 00220201 a0140220 3e048e00 338048e1 0244801e 40101400 c0000000 08220000 b00000c1 09000318 00460011 60045000 008142c0 |