On Target NOS2_HUMAN 0.3655914/CHEMBL7889
For the given ligand Lisinopril, we have found in our database that, being scored 0.3655914, the most similar ligand is CHEMBL7889. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL7889 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | CC(=N)NCCCC[C@H](N)C(=O)O |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00010000 01000000 00100000 00000400 00080000 00000000 00000000 20000000 00000200 00000083 00200000 40013000 0400800a 00800000 00000000 00180008 00000000 00000000 00402000 00000201 00000000 10000a30 03000000 00100010 00000000 00000000 40000000 10000000 00000010 00040000 80000000 00000200 |