On Target SCN9A_HUMAN 0.5511364/CHEMBL2164397
For the given ligand Moexipril, we have found in our database that, being scored 0.5511364, the most similar ligand is CHEMBL2164397. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL2164397 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | FC(F)(F)Oc1ccc(CNC(=O)C2N(CCC3CCOCC3)C(=O)c4ccccc24)cc1 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00008008 01803808 20900108 14010700 80081030 00008000 02040080 22001008 00000080 000908c0 08200000 4041b000 03008882 01202000 c1000401 00081008 00802210 02000000 00400000 00020201 80820020 382686c0 01004009 8350001c 00000400 c0200100 00224000 d0000000 0e000300 01060003 a0046000 00000600 |