On Target SCN9A_HUMAN 0.47058824/CHEMBL3341996
For the given ligand Ramipril, we have found in our database that, being scored 0.47058824, the most similar ligand is CHEMBL3341996. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL3341996 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | CC(C)COc1ccc(C)cc1c2cccc(c2)[C@H]3CC[C@]4(CCN(C)C4=O)N3 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 0403a000 01001408 2010010a 04010600 00001001 06000010 12040000 22003000 00100800 000909e0 08300000 4001b000 06c0881a 00202000 81000401 00082008 00020000 22009000 04002000 00020201 00000100 380c8630 11000001 02504018 00000000 c0000080 18020000 90000049 08004302 10060013 20064200 00802600 |