On Target PRGR_HUMAN 0.33783785/CHEMBL414318
For the given ligand Fosinopril, we have found in our database that, being scored 0.33783785, the most similar ligand is CHEMBL414318. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL414318 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C[C@@H]4CC(CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C)OCCN(C)c5ccc(cc5)[C@H]6C[C@@]7(C)[C@@H](CC[C@@]7(O)C#C)[C@@H]8CCC9=CC(=O)CCC9=C68 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00014002 01044800 00101102 c0010700 40482080 00800001 00000081 20000402 01000800 009888c8 08340084 4001b000 0602800a 22a08000 8008144a 0009100c 10840000 02100020 0a692080 02000a01 40100128 18000e90 33008000 0050001a 10200400 80000000 08404200 90000080 00008202 81060203 24024800 00000600 |