On Target PRGR_HUMAN 0.42328042/CHEMBL1163975
For the given ligand Moexipril, we have found in our database that, being scored 0.42328042, the most similar ligand is CHEMBL1163975. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL1163975 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | COc1cc(cc(OC)c1OC)C(CC(=O)c2cccc(C)c2)Nc3ccc(cc3)[N+](=O)[O-] |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00004003 47001a18 2010010a 00010600 20001001 40002000 42040000 02001000 14000800 000808e0 0c300004 5000d000 0c01c802 20200000 21120141 080e8018 00040000 02000004 08080018 00020a01 40120100 18068200 21010000 00448014 00000800 c0000000 00320000 900000a0 02008300 0006000a 80040000 04000600 |