On Target PRGR_HUMAN 0.43125/CHEMBL436859
For the given ligand Lisinopril, we have found in our database that, being scored 0.43125, the most similar ligand is CHEMBL436859. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL436859 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | C[C@H](CCC(=O)N[C@@H](CCC(=O)N(C)c1ccc(cc1)[C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C#C)[C@@H]4CCC5=CC(=O)CCC5=C24)C(=O)O)[C@H]6CC[C@H]7[C@@H]8[C@H](O)C[C@@H]9C[C@H](O)CC[C@]9(C)[C@H]8C[C@H](O)[C@]67C |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00034002 01045800 00100102 40010600 60482080 00802001 00000081 20000402 01200800 009a88c8 08380084 4003b000 0602803a 23b08000 800a0442 0009000c 10040000 02100020 0a692080 02000a01 40100108 18040e90 2300a000 0050001a 00200000 80000000 00404200 90000080 00008002 81060203 24024800 00802600 |