On Target AA2AR_HUMAN 0.46192893/CHEMBL554840
For the given ligand Moexipril, we have found in our database that, being scored 0.46192893, the most similar ligand is CHEMBL554840. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL554840 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | CCCN(CCc1ccc(NC(=O)CCC(N)C(=O)NCCCCC(NC(=O)CCC(=O)NCCOCCOCCNC(=O)C(CCCCNC(=O)C)NC(=O)C)C(=O)N)cc1)C2CCc3c(O)cccc3C2 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00034002 43007a08 20100102 c4010600 200000a0 c0002000 02000000 20000249 00202880 000a08c0 08380004 4083b040 0600801a 0030a000 801a1048 020d2008 10040200 02000000 08002000 00020201 40100100 38240630 36006001 8b500018 00000400 80000001 00800000 100000a1 0c008202 0006c00b 20004000 00802600 |