On Target AA2AR_HUMAN 0.5241379/CHEMBL3350613
For the given ligand Lisinopril, we have found in our database that, being scored 0.5241379, the most similar ligand is CHEMBL3350613. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL3350613 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | CC(C)(C)OC(=O)C1CCCN1C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(=O)N)NC(=O)OCc3ccccc3 |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 01030000 01407400 00100102 84010700 00080080 0001c010 00000000 2000000c 00b00b80 000809e0 08300000 4003b000 0e008012 01212002 80381008 021a1008 10820000 02080401 00400890 00000201 00000120 38280eb0 13000041 83500018 00004400 80002002 00000000 10200021 0c000202 00060013 e0004000 00802600 |