On Target DRD4_HUMAN 0.32967034/CHEMBL20444
For the given ligand Captopril, we have found in our database that, being scored 0.32967034, the most similar ligand is CHEMBL20444. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL20444 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CCCC(C)(C)C(=O)NCCCCN1CCN(CC1)c2ccc(Cl)cc2 |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 0001c002 01001000 00100020 04000600 00000000 00000000 00000000 20000000 00200000 00000ac0 00200004 40039800 06008006 00002000 00000040 00000000 00040000 00000000 08000000 00000201 40100000 38040700 20000021 0210001a 00002000 00000000 00080000 10000080 08008000 00060001 00000000 02022200 |