On Target DRD4_HUMAN 0.49122807/CHEMBL3335544
For the given ligand Ramipril, we have found in our database that, being scored 0.49122807, the most similar ligand is CHEMBL3335544. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL3335544 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | C(Cc1ccccc1)C2CN(Cc3ccccc3)CCO2 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00000008 01000008 00100102 80010700 00000080 00000000 00000000 22001000 00100800 000808c0 08300000 40018000 00000802 00200000 00081408 00081108 10000000 02000000 00400000 00000201 00000120 18008000 13000040 00500010 10000400 c0000000 00000000 90000001 00000300 00060002 20040000 00000600 |