On Target PGH2_HUMAN 0.35164836/CHEMBL3809156
For the given ligand Fosinopril, we have found in our database that, being scored 0.35164836, the most similar ligand is CHEMBL3809156. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL3809156 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | COC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)CN |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00010000 01007200 00100100 04010700 00080080 00000000 00000000 2000000c 00000880 000808c0 08300000 4000b000 06008002 00002001 80181000 000c0008 10820000 02000000 00400008 00000201 00000100 38240e00 13000003 83400018 00000800 80000000 00800000 10000001 0c000200 0006000b 20004000 00002600 |