On Target PGH2_HUMAN 0.7027027/CHEMBL3809156
For the given ligand Ramipril, we have found in our database that, being scored 0.7027027, the most similar ligand is CHEMBL3809156. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL3809156 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | COC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)CN |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00010000 01007200 00100100 04010700 00080080 00000000 00000000 2000000c 00000880 000808c0 08300000 4000b000 06008002 00002001 80181000 000c0008 10820000 02000000 00400008 00000201 00000100 38240e00 13000003 83400018 00000800 80000000 00800000 10000001 0c000200 0006000b 20004000 00002600 |