On Target TRY1_HUMAN 0.38502672/CHEMBL70350
For the given ligand Fosinopril, we have found in our database that, being scored 0.38502672, the most similar ligand is CHEMBL70350. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL70350 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | OC(=O)[C@@H]1[C@@H](CC2CCNCC2)C(=O)N1C(=O)N3CCN(CC3)C(=O)CCCCCc4ccccc4 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00070010 01007000 00100102 04010e00 00180080 00000000 00000004 20002008 00000800 000a08c0 08300000 5001b000 0e00b00a 00a02000 80080001 00080008 30000010 02000001 00402050 00000201 00020100 38050e10 03000021 02500018 00012000 80000000 00000000 10000000 08000002 00060003 200a4000 00800e00 |