On Target TRY1_HUMAN 0.521327/CHEMBL366921
For the given ligand Moexipril, we have found in our database that, being scored 0.521327, the most similar ligand is CHEMBL366921. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL366921 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | COc1cc([C@@H](Nc2ccc(cc2)C(=N)N)C(=O)N[C@H](C(=O)O)c3ccccc3)c(cc1OCc4ccccc4)C(=O)Cc5ccccc5 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 0400400a 46804808 20500129 94210600 000010e0 c000c002 02040080 02001001 00000980 00090a43 08300004 4080f000 0380c882 2021a081 c11c4441 22088008 18040210 02000000 08480000 00020201 c0920100 38328ee0 23414000 83c4901e 00000000 c0002181 40320000 80010080 0c008308 0086000b e0047020 00000700 |