On Target 5HT1B_HUMAN 0.26363635/CHEMBL191460
For the given ligand Captopril, we have found in our database that, being scored 0.26363635, the most similar ligand is CHEMBL191460. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL191460 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CN(C)CCN(Cc1ccc(cc1)c2ccc(CNCCc3ccccc3)cc2)C(=O)CCC4CCCC4.OC(=O)C(F)(F)F.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00012000 01802000 00100100 04010600 00000000 00000000 00000000 22001008 00000180 000908c0 08200000 40019000 8400880a 00002000 00000400 00080008 00020000 02000000 04002000 10000205 80000000 38208e10 10000001 83500018 00000000 c0000000 00000000 90000040 0c004100 01060003 20060000 00000600 |