On Target 5HT1B_HUMAN 0.45238096/CHEMBL191460
For the given ligand Ramipril, we have found in our database that, being scored 0.45238096, the most similar ligand is CHEMBL191460. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL191460 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | CN(C)CCN(Cc1ccc(cc1)c2ccc(CNCCc3ccccc3)cc2)C(=O)CCC4CCCC4.OC(=O)C(F)(F)F.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00012000 01802000 00100100 04010600 00000000 00000000 00000000 22001008 00000180 000908c0 08200000 40019000 8400880a 00002000 00000400 00080008 00020000 02000000 04002000 10000205 80000000 38208e10 10000001 83500018 00000000 c0000000 00000000 90000040 0c004100 01060003 20060000 00000600 |