On Target TLR4_HUMAN 0.3877551/CHEMBL382272
For the given ligand Moexipril, we have found in our database that, being scored 0.3877551, the most similar ligand is CHEMBL382272. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL382272 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | CCCCCCCCCCCCCC(=O)N[C@H](COCC[C@@H](CCCCCCC)OC(=O)CCCCCCCCCCC)COP(=O)(O)OCCNC(=O)C(Cc1ccc(O)cc1)C(=O)O |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00010040 01004208 20100100 80010f00 000800c4 00080000 02004040 20002000 00000900 010808c0 08300000 c0019000 1c00800a 00820020 000a1008 000c1608 108e00a0 02800000 21c02018 00023203 00000120 1c000e10 330000c0 00500018 10001c01 80000000 02920000 10010001 00000200 0006001b 01020000 00018600 |